C26H31NO3 — CID 143545174
1-[[4-[5-(3-ethylpentyl)-1-benzofuran-2-yl]phenyl]methyl]azetidine-3-carboxylic acid (PubChem CID 143545174) has the molecular formula C26H31NO3 and a molecular weight of 405.54 g/mol. Its IUPAC name is 1-[[4-[5-(3-ethylpentyl)-1-benzofuran-2-yl]phenyl]methyl]azetidine-3-carboxylic acid.
| Compound Name | 1-[[4-[5-(3-ethylpentyl)-1-benzofuran-2-yl]phenyl]methyl]azetidine-3-carboxylic acid |
|---|---|
| PubChem CID | 143545174 |
| Molecular Formula | C26H31NO3 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.23 |
| IUPAC Name | 1-[[4-[5-(3-ethylpentyl)-1-benzofuran-2-yl]phenyl]methyl]azetidine-3-carboxylic acid |
| SMILES | CCC(CC)CCc1ccc2oc(-c3ccc(CN4CC(C(=O)O)C4)cc3)cc2c1 |
| InChI | InChI=1S/C26H31NO3/c1-3-18(4-2)5-6-19-9-12-24-22(13-19)14-25(30-24)21-10-7-20(8-11-21)15-27-16-23(17-27)26(28)29/h7-14,18,23H,3-6,15-17H2,1-2H3,(H,28,29) |
| InChIKey | QRBOQUIEJNZJEI-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 53.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |