C32H41NO3 — CID 143545292
N-[[4-[(E)-2-(5-benzyl-2-methoxyphenyl)ethenyl]phenyl]methyl]-N-methylethanamine;2-ethylbutanoic acid (PubChem CID 143545292) has the molecular formula C32H41NO3 and a molecular weight of 487.68 g/mol. Its IUPAC name is N-[[4-[(E)-2-(5-benzyl-2-methoxyphenyl)ethenyl]phenyl]methyl]-N-methylethanamine;2-ethylbutanoic acid.
| Compound Name | N-[[4-[(E)-2-(5-benzyl-2-methoxyphenyl)ethenyl]phenyl]methyl]-N-methylethanamine;2-ethylbutanoic acid |
|---|---|
| PubChem CID | 143545292 |
| Molecular Formula | C32H41NO3 |
| Molecular Weight | 487.68 g/mol |
| Exact Mass | 487.31 |
| IUPAC Name | N-[[4-[(E)-2-(5-benzyl-2-methoxyphenyl)ethenyl]phenyl]methyl]-N-methylethanamine;2-ethylbutanoic acid |
| SMILES | CCC(CC)C(=O)O.CCN(C)Cc1ccc(/C=C/c2cc(Cc3ccccc3)ccc2OC)cc1 |
| InChI | InChI=1S/C26H29NO.C6H12O2/c1-4-27(2)20-23-12-10-21(11-13-23)14-16-25-19-24(15-17-26(25)28-3)18-22-8-6-5-7-9-22;1-3-5(4-2)6(7)8/h5-17,19H,4,18,20H2,1-3H3;5H,3-4H2,1-2H3,(H,7,8)/b16-14+; |
| InChIKey | RISSTDRLHLOEBO-BACBYAOASA-N |
| XLogP | 7.42 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.68 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|