About [(2Z)-3-methylpenta-2,4-dienylidene]-(2-sulfanylethyl)azanium
[(2Z)-3-methylpenta-2,4-dienylidene]-(2-sulfanylethyl)azanium (PubChem CID 143546861) has the molecular formula C8H14NS+
and a molecular weight of 156.27 g/mol. Its IUPAC name is [(2Z)-3-methylpenta-2,4-dienylidene]-(2-sulfanylethyl)azanium.
Molecular Properties
| Compound Name | [(2Z)-3-methylpenta-2,4-dienylidene]-(2-sulfanylethyl)azanium |
| PubChem CID | 143546861 |
| Molecular Formula | C8H14NS+ |
| Molecular Weight | 156.27 g/mol |
| Exact Mass | 156.08 |
| IUPAC Name | [(2Z)-3-methylpenta-2,4-dienylidene]-(2-sulfanylethyl)azanium |
| SMILES | C=C/C(C)=C\C=[NH+]\CCS |
| InChI | InChI=1S/C8H13NS/c1-3-8(2)4-5-9-6-7-10/h3-5,10H,1,6-7H2,2H3/p+1/b8-4-,9-5+ |
| InChIKey | GRSNLAGEHXKWSU-MVTUOISNSA-O |
| XLogP | 0.20 |
| TPSA | 13.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.27 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze [(2Z)-3-methylpenta-2,4-dienylidene]-(2-sulfanylethyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2Z)-3-methylpenta-2,4-dienylidene]-(2-sulfanylethyl)azanium?
The IUPAC name of [(2Z)-3-methylpenta-2,4-dienylidene]-(2-sulfanylethyl)azanium (CID 143546861) is [(2Z)-3-methylpenta-2,4-dienylidene]-(2-sulfanylethyl)azanium.
What is the SMILES notation for [(2Z)-3-methylpenta-2,4-dienylidene]-(2-sulfanylethyl)azanium?
The canonical SMILES for [(2Z)-3-methylpenta-2,4-dienylidene]-(2-sulfanylethyl)azanium is C=C/C(C)=C\C=[NH+]\CCS.
What is the InChIKey of [(2Z)-3-methylpenta-2,4-dienylidene]-(2-sulfanylethyl)azanium?
The InChIKey is GRSNLAGEHXKWSU-MVTUOISNSA-O. The full InChI is InChI=1S/C8H13NS/c1-3-8(2)4-5-9-6-7-10/h3-5,10H,1,6-7H2,2H3/p+1/b8-4-,9-5+.
What are the key properties of [(2Z)-3-methylpenta-2,4-dienylidene]-(2-sulfanylethyl)azanium?
[(2Z)-3-methylpenta-2,4-dienylidene]-(2-sulfanylethyl)azanium has a molecular weight of 156.27 g/mol, XLogP of 0.20, 4 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(2Z)-3-methylpenta-2,4-dienylidene]-(2-sulfanylethyl)azanium is sourced from PubChem (CID 143546861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).