C8H13NS — CID 143546862
2-[[(2Z)-3-methylpenta-2,4-dienylidene]amino]ethanethiol (PubChem CID 143546862) has the molecular formula C8H13NS and a molecular weight of 155.27 g/mol. Its IUPAC name is 2-[[(2Z)-3-methylpenta-2,4-dienylidene]amino]ethanethiol.
| Compound Name | 2-[[(2Z)-3-methylpenta-2,4-dienylidene]amino]ethanethiol |
|---|---|
| PubChem CID | 143546862 |
| Molecular Formula | C8H13NS |
| Molecular Weight | 155.27 g/mol |
| Exact Mass | 155.08 |
| IUPAC Name | 2-[[(2Z)-3-methylpenta-2,4-dienylidene]amino]ethanethiol |
| SMILES | C=C/C(C)=C\C=N\CCS |
| InChI | InChI=1S/C8H13NS/c1-3-8(2)4-5-9-6-7-10/h3-5,10H,1,6-7H2,2H3/b8-4-,9-5+ |
| InChIKey | GRSNLAGEHXKWSU-MVTUOISNSA-N |
| XLogP | 2.12 |
| TPSA | 12.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.27 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|