C7H13NS — CID 145271242
(2Z)-N,3-dimethylpenta-2,4-dien-1-imine;sulfane (PubChem CID 145271242) has the molecular formula C7H13NS and a molecular weight of 143.25 g/mol. Its IUPAC name is (2Z)-N,3-dimethylpenta-2,4-dien-1-imine;sulfane.
| Compound Name | (2Z)-N,3-dimethylpenta-2,4-dien-1-imine;sulfane |
|---|---|
| PubChem CID | 145271242 |
| Molecular Formula | C7H13NS |
| Molecular Weight | 143.25 g/mol |
| Exact Mass | 143.08 |
| IUPAC Name | (2Z)-N,3-dimethylpenta-2,4-dien-1-imine;sulfane |
| SMILES | C=C/C(C)=C\C=N\C.S |
| InChI | InChI=1S/C7H11N.H2S/c1-4-7(2)5-6-8-3;/h4-6H,1H2,2-3H3;1H2/b7-5-,8-6+; |
| InChIKey | JYXJBENNNJNCNL-KHCQPJBVSA-N |
| XLogP | 1.93 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.25 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|