C9H18N2 — CID 143547335
ethane;1-prop-1-en-2-yl-5,6-dihydro-4H-pyrimidine (PubChem CID 143547335) has the molecular formula C9H18N2 and a molecular weight of 154.26 g/mol. Its IUPAC name is ethane;1-prop-1-en-2-yl-5,6-dihydro-4H-pyrimidine.
| Compound Name | ethane;1-prop-1-en-2-yl-5,6-dihydro-4H-pyrimidine |
|---|---|
| PubChem CID | 143547335 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | ethane;1-prop-1-en-2-yl-5,6-dihydro-4H-pyrimidine |
| SMILES | C=C(C)N1C=NCCC1.CC |
| InChI | InChI=1S/C7H12N2.C2H6/c1-7(2)9-5-3-4-8-6-9;1-2/h6H,1,3-5H2,2H3;1-2H3 |
| InChIKey | ADEUZFPUDYXZMS-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |