About 1-methyl-6-methylidene-4,5-dihydropyrimidine
1-methyl-6-methylidene-4,5-dihydropyrimidine (PubChem CID 91610482) has the molecular formula C6H10N2
and a molecular weight of 110.16 g/mol. Its IUPAC name is 1-methyl-6-methylidene-4,5-dihydropyrimidine.
Analyze 1-methyl-6-methylidene-4,5-dihydropyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-6-methylidene-4,5-dihydropyrimidine?
The IUPAC name of 1-methyl-6-methylidene-4,5-dihydropyrimidine (CID 91610482) is 1-methyl-6-methylidene-4,5-dihydropyrimidine.
What is the SMILES notation for 1-methyl-6-methylidene-4,5-dihydropyrimidine?
The canonical SMILES for 1-methyl-6-methylidene-4,5-dihydropyrimidine is C=C1CCN=CN1C.
What is the InChIKey of 1-methyl-6-methylidene-4,5-dihydropyrimidine?
The InChIKey is ZJTSYPVPOZYQMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2/c1-6-3-4-7-5-8(6)2/h5H,1,3-4H2,2H3.
What are the key properties of 1-methyl-6-methylidene-4,5-dihydropyrimidine?
1-methyl-6-methylidene-4,5-dihydropyrimidine has a molecular weight of 110.16 g/mol, XLogP of 0.86, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-6-methylidene-4,5-dihydropyrimidine is sourced from PubChem (CID 91610482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).