About 1,2-dimethyl-6-methylidene-4,5-dihydropyrimidine
1,2-dimethyl-6-methylidene-4,5-dihydropyrimidine (PubChem CID 58003476) has the molecular formula C7H12N2
and a molecular weight of 124.19 g/mol. Its IUPAC name is 1,2-dimethyl-6-methylidene-4,5-dihydropyrimidine.
Analyze 1,2-dimethyl-6-methylidene-4,5-dihydropyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dimethyl-6-methylidene-4,5-dihydropyrimidine?
The IUPAC name of 1,2-dimethyl-6-methylidene-4,5-dihydropyrimidine (CID 58003476) is 1,2-dimethyl-6-methylidene-4,5-dihydropyrimidine.
What is the SMILES notation for 1,2-dimethyl-6-methylidene-4,5-dihydropyrimidine?
The canonical SMILES for 1,2-dimethyl-6-methylidene-4,5-dihydropyrimidine is C=C1CCN=C(C)N1C.
What is the InChIKey of 1,2-dimethyl-6-methylidene-4,5-dihydropyrimidine?
The InChIKey is YZHJUVBHIZXKLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2/c1-6-4-5-8-7(2)9(6)3/h1,4-5H2,2-3H3.
What are the key properties of 1,2-dimethyl-6-methylidene-4,5-dihydropyrimidine?
1,2-dimethyl-6-methylidene-4,5-dihydropyrimidine has a molecular weight of 124.19 g/mol, XLogP of 1.25, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dimethyl-6-methylidene-4,5-dihydropyrimidine is sourced from PubChem (CID 58003476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).