About 2,3-dimethyl-7-methylidene-5,6-dihydro-4H-1,3-diazepine
2,3-dimethyl-7-methylidene-5,6-dihydro-4H-1,3-diazepine (PubChem CID 143829285) has the molecular formula C8H14N2
and a molecular weight of 138.21 g/mol. Its IUPAC name is 2,3-dimethyl-7-methylidene-5,6-dihydro-4H-1,3-diazepine.
Analyze 2,3-dimethyl-7-methylidene-5,6-dihydro-4H-1,3-diazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethyl-7-methylidene-5,6-dihydro-4H-1,3-diazepine?
The IUPAC name of 2,3-dimethyl-7-methylidene-5,6-dihydro-4H-1,3-diazepine (CID 143829285) is 2,3-dimethyl-7-methylidene-5,6-dihydro-4H-1,3-diazepine.
What is the SMILES notation for 2,3-dimethyl-7-methylidene-5,6-dihydro-4H-1,3-diazepine?
The canonical SMILES for 2,3-dimethyl-7-methylidene-5,6-dihydro-4H-1,3-diazepine is C=C1CCCN(C)C(C)=N1.
What is the InChIKey of 2,3-dimethyl-7-methylidene-5,6-dihydro-4H-1,3-diazepine?
The InChIKey is MSYSSHDZDZAKCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2/c1-7-5-4-6-10(3)8(2)9-7/h1,4-6H2,2-3H3.
What are the key properties of 2,3-dimethyl-7-methylidene-5,6-dihydro-4H-1,3-diazepine?
2,3-dimethyl-7-methylidene-5,6-dihydro-4H-1,3-diazepine has a molecular weight of 138.21 g/mol, XLogP of 1.64, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethyl-7-methylidene-5,6-dihydro-4H-1,3-diazepine is sourced from PubChem (CID 143829285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).