C6H10N2 — CID 142929765
2,3-dimethyl-5-methylidene-4H-imidazole (PubChem CID 142929765) has the molecular formula C6H10N2 and a molecular weight of 110.16 g/mol. Its IUPAC name is 2,3-dimethyl-5-methylidene-4H-imidazole.
| Compound Name | 2,3-dimethyl-5-methylidene-4H-imidazole |
|---|---|
| PubChem CID | 142929765 |
| Molecular Formula | C6H10N2 |
| Molecular Weight | 110.16 g/mol |
| Exact Mass | 110.08 |
| IUPAC Name | 2,3-dimethyl-5-methylidene-4H-imidazole |
| SMILES | C=C1CN(C)C(C)=N1 |
| InChI | InChI=1S/C6H10N2/c1-5-4-8(3)6(2)7-5/h1,4H2,2-3H3 |
| InChIKey | DVBVFQOXUVNQIB-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 110.16 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |