About 2-methyl-5-methylidene-1,4-dihydroimidazole
2-methyl-5-methylidene-1,4-dihydroimidazole (PubChem CID 58059446) has the molecular formula C5H8N2
and a molecular weight of 96.13 g/mol. Its IUPAC name is 2-methyl-5-methylidene-1,4-dihydroimidazole.
Analyze 2-methyl-5-methylidene-1,4-dihydroimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-5-methylidene-1,4-dihydroimidazole?
The IUPAC name of 2-methyl-5-methylidene-1,4-dihydroimidazole (CID 58059446) is 2-methyl-5-methylidene-1,4-dihydroimidazole.
What is the SMILES notation for 2-methyl-5-methylidene-1,4-dihydroimidazole?
The canonical SMILES for 2-methyl-5-methylidene-1,4-dihydroimidazole is C=C1CN=C(C)N1.
What is the InChIKey of 2-methyl-5-methylidene-1,4-dihydroimidazole?
The InChIKey is LSIRKAYWVUDTPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N2/c1-4-3-6-5(2)7-4/h1,3H2,2H3,(H,6,7).
What are the key properties of 2-methyl-5-methylidene-1,4-dihydroimidazole?
2-methyl-5-methylidene-1,4-dihydroimidazole has a molecular weight of 96.13 g/mol, XLogP of 0.52, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-5-methylidene-1,4-dihydroimidazole is sourced from PubChem (CID 58059446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).