C7H12N4 — CID 88918609
N'-[(E)-(2-methyl-5-methylidene-1H-imidazol-4-ylidene)methyl]methanediamine (PubChem CID 88918609) has the molecular formula C7H12N4 and a molecular weight of 152.20 g/mol. Its IUPAC name is N'-[(E)-(2-methyl-5-methylidene-1H-imidazol-4-ylidene)methyl]methanediamine.
| Compound Name | N'-[(E)-(2-methyl-5-methylidene-1H-imidazol-4-ylidene)methyl]methanediamine |
|---|---|
| PubChem CID | 88918609 |
| Molecular Formula | C7H12N4 |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.11 |
| IUPAC Name | N'-[(E)-(2-methyl-5-methylidene-1H-imidazol-4-ylidene)methyl]methanediamine |
| SMILES | C=c1[nH]c(C)n/c1=C/NCN |
| InChI | InChI=1S/C7H12N4/c1-5-7(3-9-4-8)11-6(2)10-5/h3,9H,1,4,8H2,2H3,(H,10,11)/b7-3+ |
| InChIKey | OYTMBSWGGMFLLZ-XVNBXDOJSA-N |
| XLogP | -1.63 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|