C6H8N2 — CID 59908997
2-methyl-4,5-dimethylidene-1H-imidazole (PubChem CID 59908997) has the molecular formula C6H8N2 and a molecular weight of 108.14 g/mol. Its IUPAC name is 2-methyl-4,5-dimethylidene-1H-imidazole.
| Compound Name | 2-methyl-4,5-dimethylidene-1H-imidazole |
|---|---|
| PubChem CID | 59908997 |
| Molecular Formula | C6H8N2 |
| Molecular Weight | 108.14 g/mol |
| Exact Mass | 108.07 |
| IUPAC Name | 2-methyl-4,5-dimethylidene-1H-imidazole |
| SMILES | C=c1nc(C)[nH]c1=C |
| InChI | InChI=1S/C6H8N2/c1-4-5(2)8-6(3)7-4/h1-2H2,3H3,(H,7,8) |
| InChIKey | RHRKADRRJAZWRG-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 108.14 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |