C7H10N2 — CID 123822050
(4E)-4-ethylidene-2-methyl-5-methylidene-1H-imidazole (PubChem CID 123822050) has the molecular formula C7H10N2 and a molecular weight of 122.17 g/mol. Its IUPAC name is (4E)-4-ethylidene-2-methyl-5-methylidene-1H-imidazole.
| Compound Name | (4E)-4-ethylidene-2-methyl-5-methylidene-1H-imidazole |
|---|---|
| PubChem CID | 123822050 |
| Molecular Formula | C7H10N2 |
| Molecular Weight | 122.17 g/mol |
| Exact Mass | 122.08 |
| IUPAC Name | (4E)-4-ethylidene-2-methyl-5-methylidene-1H-imidazole |
| SMILES | C=c1[nH]c(C)n/c1=C/C |
| InChI | InChI=1S/C7H10N2/c1-4-7-5(2)8-6(3)9-7/h4H,2H2,1,3H3,(H,8,9)/b7-4+ |
| InChIKey | IZVKSYLBQRBZBZ-QPJJXVBHSA-N |
| XLogP | -0.07 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 122.17 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |