C8H7N2Y- — CID 59098032
2-methyl-1,7-dihydrobenzimidazol-7-ide;yttrium (PubChem CID 59098032) has the molecular formula C8H7N2Y- and a molecular weight of 220.06 g/mol. Its IUPAC name is 2-methyl-1,7-dihydrobenzimidazol-7-ide;yttrium.
| Compound Name | 2-methyl-1,7-dihydrobenzimidazol-7-ide;yttrium |
|---|---|
| PubChem CID | 59098032 |
| Molecular Formula | C8H7N2Y- |
| Molecular Weight | 220.06 g/mol |
| Exact Mass | 219.97 |
| IUPAC Name | 2-methyl-1,7-dihydrobenzimidazol-7-ide;yttrium |
| SMILES | Cc1nc2ccc[c-]c2[nH]1.[Y] |
| InChI | InChI=1S/C8H7N2.Y/c1-6-9-7-4-2-3-5-8(7)10-6;/h2-4H,1H3,(H,9,10);/q-1; |
| InChIKey | RPESEVGXNLIZLH-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.06 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|