C9H13N3 — CID 123452172
[(4E)-4-but-2-enylidene-5-methylidene-1H-imidazol-2-yl]methanamine (PubChem CID 123452172) has the molecular formula C9H13N3 and a molecular weight of 163.22 g/mol. Its IUPAC name is [(4E)-4-but-2-enylidene-5-methylidene-1H-imidazol-2-yl]methanamine.
| Compound Name | [(4E)-4-but-2-enylidene-5-methylidene-1H-imidazol-2-yl]methanamine |
|---|---|
| PubChem CID | 123452172 |
| Molecular Formula | C9H13N3 |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.11 |
| IUPAC Name | [(4E)-4-but-2-enylidene-5-methylidene-1H-imidazol-2-yl]methanamine |
| SMILES | C=c1[nH]c(CN)n/c1=C/C=CC |
| InChI | InChI=1S/C9H13N3/c1-3-4-5-8-7(2)11-9(6-10)12-8/h3-5H,2,6,10H2,1H3,(H,11,12)/b4-3?,8-5+ |
| InChIKey | BZWRDIKNCGSUFR-JKAWOYHNSA-N |
| XLogP | -0.36 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |