About N-but-1-en-2-yl-N'-methyl-N-propylpropanimidamide;ethane
N-but-1-en-2-yl-N'-methyl-N-propylpropanimidamide;ethane (PubChem CID 142805037) has the molecular formula C13H28N2
and a molecular weight of 212.38 g/mol. Its IUPAC name is N-but-1-en-2-yl-N'-methyl-N-propylpropanimidamide;ethane.
Molecular Properties
| Compound Name | N-but-1-en-2-yl-N'-methyl-N-propylpropanimidamide;ethane |
| PubChem CID | 142805037 |
| Molecular Formula | C13H28N2 |
| Molecular Weight | 212.38 g/mol |
| Exact Mass | 212.23 |
| IUPAC Name | N-but-1-en-2-yl-N'-methyl-N-propylpropanimidamide;ethane |
| SMILES | C=C(CC)N(CCC)/C(CC)=N/C.CC |
| InChI | InChI=1S/C11H22N2.C2H6/c1-6-9-13(10(4)7-2)11(8-3)12-5;1-2/h4,6-9H2,1-3,5H3;1-2H3/b12-11+; |
| InChIKey | NSNGIWDYOCDSKS-CALJPSDSSA-N |
| XLogP | 4.09 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.38 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-but-1-en-2-yl-N'-methyl-N-propylpropanimidamide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-but-1-en-2-yl-N'-methyl-N-propylpropanimidamide;ethane?
The IUPAC name of N-but-1-en-2-yl-N'-methyl-N-propylpropanimidamide;ethane (CID 142805037) is N-but-1-en-2-yl-N'-methyl-N-propylpropanimidamide;ethane.
What is the SMILES notation for N-but-1-en-2-yl-N'-methyl-N-propylpropanimidamide;ethane?
The canonical SMILES for N-but-1-en-2-yl-N'-methyl-N-propylpropanimidamide;ethane is C=C(CC)N(CCC)/C(CC)=N/C.CC.
What is the InChIKey of N-but-1-en-2-yl-N'-methyl-N-propylpropanimidamide;ethane?
The InChIKey is NSNGIWDYOCDSKS-CALJPSDSSA-N. The full InChI is InChI=1S/C11H22N2.C2H6/c1-6-9-13(10(4)7-2)11(8-3)12-5;1-2/h4,6-9H2,1-3,5H3;1-2H3/b12-11+;.
What are the key properties of N-but-1-en-2-yl-N'-methyl-N-propylpropanimidamide;ethane?
N-but-1-en-2-yl-N'-methyl-N-propylpropanimidamide;ethane has a molecular weight of 212.38 g/mol, XLogP of 4.09, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-but-1-en-2-yl-N'-methyl-N-propylpropanimidamide;ethane is sourced from PubChem (CID 142805037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).