C14H24N4+2 — CID 91381855
1,1,2-trimethyl-5-[2-(2,3,3-trimethylimidazol-3-ium-4-yl)ethyl]imidazol-1-ium (PubChem CID 91381855) has the molecular formula C14H24N4+2 and a molecular weight of 248.37 g/mol. Its IUPAC name is 1,1,2-trimethyl-5-[2-(2,3,3-trimethylimidazol-3-ium-4-yl)ethyl]imidazol-1-ium.
| Compound Name | 1,1,2-trimethyl-5-[2-(2,3,3-trimethylimidazol-3-ium-4-yl)ethyl]imidazol-1-ium |
|---|---|
| PubChem CID | 91381855 |
| Molecular Formula | C14H24N4+2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.20 |
| IUPAC Name | 1,1,2-trimethyl-5-[2-(2,3,3-trimethylimidazol-3-ium-4-yl)ethyl]imidazol-1-ium |
| SMILES | CC1=NC=C(CCC2=CN=C(C)[N+]2(C)C)[N+]1(C)C |
| InChI | InChI=1S/C14H24N4/c1-11-15-9-13(17(11,3)4)7-8-14-10-16-12(2)18(14,5)6/h9-10H,7-8H2,1-6H3/q+2 |
| InChIKey | UDAPAAHJWJZIKY-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|