C10H19N2+ — CID 122699323
1-butyl-1,2,4-trimethylimidazol-1-ium (PubChem CID 122699323) has the molecular formula C10H19N2+ and a molecular weight of 167.28 g/mol. Its IUPAC name is 1-butyl-1,2,4-trimethylimidazol-1-ium.
| Compound Name | 1-butyl-1,2,4-trimethylimidazol-1-ium |
|---|---|
| PubChem CID | 122699323 |
| Molecular Formula | C10H19N2+ |
| Molecular Weight | 167.28 g/mol |
| Exact Mass | 167.15 |
| IUPAC Name | 1-butyl-1,2,4-trimethylimidazol-1-ium |
| SMILES | CCCC[N+]1(C)C=C(C)N=C1C |
| InChI | InChI=1S/C10H19N2/c1-5-6-7-12(4)8-9(2)11-10(12)3/h8H,5-7H2,1-4H3/q+1 |
| InChIKey | QOVZMIHAAZISCN-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.28 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|