C10H17F3N2 — CID 143705958
N-but-1-en-2-yl-2,2,2-trifluoro-N'-methyl-N-propylethanimidamide (PubChem CID 143705958) has the molecular formula C10H17F3N2 and a molecular weight of 222.25 g/mol. Its IUPAC name is N-but-1-en-2-yl-2,2,2-trifluoro-N'-methyl-N-propylethanimidamide.
| Compound Name | N-but-1-en-2-yl-2,2,2-trifluoro-N'-methyl-N-propylethanimidamide |
|---|---|
| PubChem CID | 143705958 |
| Molecular Formula | C10H17F3N2 |
| Molecular Weight | 222.25 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | N-but-1-en-2-yl-2,2,2-trifluoro-N'-methyl-N-propylethanimidamide |
| SMILES | C=C(CC)N(CCC)/C(=N/C)C(F)(F)F |
| InChI | InChI=1S/C10H17F3N2/c1-5-7-15(8(3)6-2)9(14-4)10(11,12)13/h3,5-7H2,1-2,4H3/b14-9+ |
| InChIKey | HRBWJVGUFOMBRB-NTEUORMPSA-N |
| XLogP | 3.21 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.25 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|