C7H14N2 — CID 123563027
N'-but-1-en-2-yl-N,N-dimethylmethanimidamide (PubChem CID 123563027) has the molecular formula C7H14N2 and a molecular weight of 126.20 g/mol. Its IUPAC name is N'-but-1-en-2-yl-N,N-dimethylmethanimidamide.
| Compound Name | N'-but-1-en-2-yl-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 123563027 |
| Molecular Formula | C7H14N2 |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.12 |
| IUPAC Name | N'-but-1-en-2-yl-N,N-dimethylmethanimidamide |
| SMILES | C=C(CC)/N=C/N(C)C |
| InChI | InChI=1S/C7H14N2/c1-5-7(2)8-6-9(3)4/h6H,2,5H2,1,3-4H3/b8-6+ |
| InChIKey | NBNSFVKOTDSKKO-SOFGYWHQSA-N |
| XLogP | 1.50 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|