C26H25F2NO3S — CID 143547383
[[4-[(3,5-difluorophenyl)methyl]-3-methyl-2-phenyl-1,3-oxazolidin-5-yl]-phenylsulfanylmethyl] acetate (PubChem CID 143547383) has the molecular formula C26H25F2NO3S and a molecular weight of 469.55 g/mol. Its IUPAC name is [[4-[(3,5-difluorophenyl)methyl]-3-methyl-2-phenyl-1,3-oxazolidin-5-yl]-phenylsulfanylmethyl] acetate.
| Compound Name | [[4-[(3,5-difluorophenyl)methyl]-3-methyl-2-phenyl-1,3-oxazolidin-5-yl]-phenylsulfanylmethyl] acetate |
|---|---|
| PubChem CID | 143547383 |
| Molecular Formula | C26H25F2NO3S |
| Molecular Weight | 469.55 g/mol |
| Exact Mass | 469.15 |
| IUPAC Name | [[4-[(3,5-difluorophenyl)methyl]-3-methyl-2-phenyl-1,3-oxazolidin-5-yl]-phenylsulfanylmethyl] acetate |
| SMILES | CC(=O)OC(Sc1ccccc1)C1OC(c2ccccc2)N(C)C1Cc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C26H25F2NO3S/c1-17(30)31-26(33-22-11-7-4-8-12-22)24-23(15-18-13-20(27)16-21(28)14-18)29(2)25(32-24)19-9-5-3-6-10-19/h3-14,16,23-26H,15H2,1-2H3 |
| InChIKey | RZEPLBYCEUHIRB-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.55 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|