C27H25F2NO4S — CID 91413305
[[3-acetyl-4-[(3,5-difluorophenyl)methyl]-2-phenyl-1,3-oxazolidin-5-yl]-phenylsulfanylmethyl] acetate (PubChem CID 91413305) has the molecular formula C27H25F2NO4S and a molecular weight of 497.56 g/mol. Its IUPAC name is [[3-acetyl-4-[(3,5-difluorophenyl)methyl]-2-phenyl-1,3-oxazolidin-5-yl]-phenylsulfanylmethyl] acetate.
| Compound Name | [[3-acetyl-4-[(3,5-difluorophenyl)methyl]-2-phenyl-1,3-oxazolidin-5-yl]-phenylsulfanylmethyl] acetate |
|---|---|
| PubChem CID | 91413305 |
| Molecular Formula | C27H25F2NO4S |
| Molecular Weight | 497.56 g/mol |
| Exact Mass | 497.15 |
| IUPAC Name | [[3-acetyl-4-[(3,5-difluorophenyl)methyl]-2-phenyl-1,3-oxazolidin-5-yl]-phenylsulfanylmethyl] acetate |
| SMILES | CC(=O)OC(Sc1ccccc1)C1OC(c2ccccc2)N(C(C)=O)C1Cc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C27H25F2NO4S/c1-17(31)30-24(15-19-13-21(28)16-22(29)14-19)25(34-26(30)20-9-5-3-6-10-20)27(33-18(2)32)35-23-11-7-4-8-12-23/h3-14,16,24-27H,15H2,1-2H3 |
| InChIKey | FKAGCOQSBXSUCL-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.56 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|