C30H50O2 — CID 143549756
[(13aR)-3a,13a-diethyl-5b,8,11a-trimethyl-2,3,4,5,5a,6,7,7a,8,9,10,11,11b,12,13,13b-hexadecahydro-1H-cyclopenta[a]chrysen-9-yl] acetate (PubChem CID 143549756) has the molecular formula C30H50O2 and a molecular weight of 442.73 g/mol. Its IUPAC name is [(13aR)-3a,13a-diethyl-5b,8,11a-trimethyl-2,3,4,5,5a,6,7,7a,8,9,10,11,11b,12,13,13b-hexadecahydro-1H-cyclopenta[a]chrysen-9-yl] acetate.
| Compound Name | [(13aR)-3a,13a-diethyl-5b,8,11a-trimethyl-2,3,4,5,5a,6,7,7a,8,9,10,11,11b,12,13,13b-hexadecahydro-1H-cyclopenta[a]chrysen-9-yl] acetate |
|---|---|
| PubChem CID | 143549756 |
| Molecular Formula | C30H50O2 |
| Molecular Weight | 442.73 g/mol |
| Exact Mass | 442.38 |
| IUPAC Name | [(13aR)-3a,13a-diethyl-5b,8,11a-trimethyl-2,3,4,5,5a,6,7,7a,8,9,10,11,11b,12,13,13b-hexadecahydro-1H-cyclopenta[a]chrysen-9-yl] acetate |
| SMILES | CCC12CCCC1[C@@]1(CC)CCC3C4(C)CCC(OC(C)=O)C(C)C4CCC3(C)C1CC2 |
| InChI | InChI=1S/C30H50O2/c1-7-29-15-9-10-26(29)30(8-2)19-14-24-27(5)17-12-23(32-21(4)31)20(3)22(27)11-16-28(24,6)25(30)13-18-29/h20,22-26H,7-19H2,1-6H3/t20?,22?,23?,24?,25?,26?,27?,28?,29?,30-/m0/s1 |
| InChIKey | JEZYUNABTHSANV-HFTUODOISA-N |
| XLogP | 8.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.73 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |