C37H64N2O3 — CID 123865314
[1,4a,10b-trimethyl-7-(3-methylbutan-2-yl)-8-[2-(4-methylpiperazin-1-yl)ethyl]-8-(2-oxoethyl)-2,3,4,4b,5,6,6a,7,9,10,10a,11,12,12a-tetradecahydro-1H-chrysen-2-yl] acetate (PubChem CID 123865314) has the molecular formula C37H64N2O3 and a molecular weight of 584.93 g/mol. Its IUPAC name is [1,4a,10b-trimethyl-7-(3-methylbutan-2-yl)-8-[2-(4-methylpiperazin-1-yl)ethyl]-8-(2-oxoethyl)-2,3,4,4b,5,6,6a,7,9,10,10a,11,12,12a-tetradecahydro-1H-chrysen-2-yl] acetate.
| Compound Name | [1,4a,10b-trimethyl-7-(3-methylbutan-2-yl)-8-[2-(4-methylpiperazin-1-yl)ethyl]-8-(2-oxoethyl)-2,3,4,4b,5,6,6a,7,9,10,10a,11,12,12a-tetradecahydro-1H-chrysen-2-yl] acetate |
|---|---|
| PubChem CID | 123865314 |
| Molecular Formula | C37H64N2O3 |
| Molecular Weight | 584.93 g/mol |
| Exact Mass | 584.49 |
| IUPAC Name | [1,4a,10b-trimethyl-7-(3-methylbutan-2-yl)-8-[2-(4-methylpiperazin-1-yl)ethyl]-8-(2-oxoethyl)-2,3,4,4b,5,6,6a,7,9,10,10a,11,12,12a-tetradecahydro-1H-chrysen-2-yl] acetate |
| SMILES | CC(=O)OC1CCC2(C)C(CCC3(C)C4CCC(CC=O)(CCN5CCN(C)CC5)C(C(C)C(C)C)C4CCC23)C1C |
| InChI | InChI=1S/C37H64N2O3/c1-25(2)26(3)34-29-9-10-33-35(6)15-13-32(42-28(5)41)27(4)30(35)11-14-36(33,7)31(29)12-16-37(34,18-24-40)17-19-39-22-20-38(8)21-23-39/h24-27,29-34H,9-23H2,1-8H3 |
| InChIKey | HLLVYXMOXOEFKR-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.93 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|