C17H24F3NO6 — CID 143553257
tert-butyl 5-(2-ethoxy-2-oxoethyl)-3-(trifluoromethyl)-1H-pyrrole-2-carboxylate;ethyl formate (PubChem CID 143553257) has the molecular formula C17H24F3NO6 and a molecular weight of 395.37 g/mol. Its IUPAC name is tert-butyl 5-(2-ethoxy-2-oxoethyl)-3-(trifluoromethyl)-1H-pyrrole-2-carboxylate;ethyl formate.
| Compound Name | tert-butyl 5-(2-ethoxy-2-oxoethyl)-3-(trifluoromethyl)-1H-pyrrole-2-carboxylate;ethyl formate |
|---|---|
| PubChem CID | 143553257 |
| Molecular Formula | C17H24F3NO6 |
| Molecular Weight | 395.37 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | tert-butyl 5-(2-ethoxy-2-oxoethyl)-3-(trifluoromethyl)-1H-pyrrole-2-carboxylate;ethyl formate |
| SMILES | CCOC(=O)Cc1cc(C(F)(F)F)c(C(=O)OC(C)(C)C)[nH]1.CCOC=O |
| InChI | InChI=1S/C14H18F3NO4.C3H6O2/c1-5-21-10(19)7-8-6-9(14(15,16)17)11(18-8)12(20)22-13(2,3)4;1-2-5-3-4/h6,18H,5,7H2,1-4H3;3H,2H2,1H3 |
| InChIKey | WMHWGAIQVVIYII-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 94.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.37 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|