C22H20F3N3O3 — CID 143555152
3-[4-(azulen-6-ylamino)-3-fluorophenyl]-5-[[(2,2-difluoro-1-hydroxyethyl)amino]methyl]-1,3-oxazolidin-2-one (PubChem CID 143555152) has the molecular formula C22H20F3N3O3 and a molecular weight of 431.41 g/mol. Its IUPAC name is 3-[4-(azulen-6-ylamino)-3-fluorophenyl]-5-[[(2,2-difluoro-1-hydroxyethyl)amino]methyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[4-(azulen-6-ylamino)-3-fluorophenyl]-5-[[(2,2-difluoro-1-hydroxyethyl)amino]methyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 143555152 |
| Molecular Formula | C22H20F3N3O3 |
| Molecular Weight | 431.41 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | 3-[4-(azulen-6-ylamino)-3-fluorophenyl]-5-[[(2,2-difluoro-1-hydroxyethyl)amino]methyl]-1,3-oxazolidin-2-one |
| SMILES | O=C1OC(CNC(O)C(F)F)CN1c1ccc(Nc2ccc3cccc-3cc2)c(F)c1 |
| InChI | InChI=1S/C22H20F3N3O3/c23-18-10-16(28-12-17(31-22(28)30)11-26-21(29)20(24)25)8-9-19(18)27-15-6-4-13-2-1-3-14(13)5-7-15/h1-10,17,20-21,26-27,29H,11-12H2 |
| InChIKey | YVSPEHPTRMMGJY-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.41 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|