C19H16N4O4 — CID 143556843
4-[5-[4-(3-iminobutanoylamino)phenyl]-1,3,4-oxadiazol-2-yl]benzoic acid (PubChem CID 143556843) has the molecular formula C19H16N4O4 and a molecular weight of 364.36 g/mol. Its IUPAC name is 4-[5-[4-(3-iminobutanoylamino)phenyl]-1,3,4-oxadiazol-2-yl]benzoic acid.
| Compound Name | 4-[5-[4-(3-iminobutanoylamino)phenyl]-1,3,4-oxadiazol-2-yl]benzoic acid |
|---|---|
| PubChem CID | 143556843 |
| Molecular Formula | C19H16N4O4 |
| Molecular Weight | 364.36 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | 4-[5-[4-(3-iminobutanoylamino)phenyl]-1,3,4-oxadiazol-2-yl]benzoic acid |
| SMILES | [H]/N=C(\C)CC(=O)Nc1ccc(-c2nnc(-c3ccc(C(=O)O)cc3)o2)cc1 |
| InChI | InChI=1S/C19H16N4O4/c1-11(20)10-16(24)21-15-8-6-13(7-9-15)18-23-22-17(27-18)12-2-4-14(5-3-12)19(25)26/h2-9,20H,10H2,1H3,(H,21,24)(H,25,26)/b20-11+ |
| InChIKey | QHZUJDJWEIGBJK-RGVLZGJSSA-N |
| XLogP | 3.47 |
| TPSA | 129.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.36 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|