C14H12FN3O2 — CID 143557073
4-[4-[(1E)-3-fluoropenta-1,3-dienyl]triazol-1-yl]benzoic acid (PubChem CID 143557073) has the molecular formula C14H12FN3O2 and a molecular weight of 273.27 g/mol. Its IUPAC name is 4-[4-[(1E)-3-fluoropenta-1,3-dienyl]triazol-1-yl]benzoic acid.
| Compound Name | 4-[4-[(1E)-3-fluoropenta-1,3-dienyl]triazol-1-yl]benzoic acid |
|---|---|
| PubChem CID | 143557073 |
| Molecular Formula | C14H12FN3O2 |
| Molecular Weight | 273.27 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | 4-[4-[(1E)-3-fluoropenta-1,3-dienyl]triazol-1-yl]benzoic acid |
| SMILES | CC=C(F)/C=C/c1cn(-c2ccc(C(=O)O)cc2)nn1 |
| InChI | InChI=1S/C14H12FN3O2/c1-2-11(15)5-6-12-9-18(17-16-12)13-7-3-10(4-8-13)14(19)20/h2-9H,1H3,(H,19,20)/b6-5+,11-2? |
| InChIKey | AKCGKFMQUFJCLH-CPXMWILESA-N |
| XLogP | 2.85 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.27 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|