C28H28N2O — CID 143559101
CID 143559101 (PubChem CID 143559101) has the molecular formula C28H28N2O and a molecular weight of 408.55 g/mol.
| Compound Name | CID 143559101 |
|---|---|
| PubChem CID | 143559101 |
| Molecular Formula | C28H28N2O |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1cc2cc(NC(=O)C3(c4ccc5c6c(c7c(c5c4)[CH]7)[CH]6)CC3)ccc2[nH]1.[H][H].[H][H] |
| InChI | InChI=1S/C28H24N2O.2H2/c1-27(2,3)25-11-15-10-17(5-7-24(15)30-25)29-26(31)28(8-9-28)16-4-6-18-19(12-16)21-14-23(21)22-13-20(18)22;;/h4-7,10-14,30H,8-9H2,1-3H3,(H,29,31);2*1H |
| InChIKey | RDPPTXDXMKDSBR-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |