C19H17N3O4 — CID 71164182
5-[[1-(3,4-dihydroxyphenyl)cyclopropanecarbonyl]amino]-1H-indole-2-carboxamide (PubChem CID 71164182) has the molecular formula C19H17N3O4 and a molecular weight of 351.36 g/mol. Its IUPAC name is 5-[[1-(3,4-dihydroxyphenyl)cyclopropanecarbonyl]amino]-1H-indole-2-carboxamide.
| Compound Name | 5-[[1-(3,4-dihydroxyphenyl)cyclopropanecarbonyl]amino]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 71164182 |
| Molecular Formula | C19H17N3O4 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | 5-[[1-(3,4-dihydroxyphenyl)cyclopropanecarbonyl]amino]-1H-indole-2-carboxamide |
| SMILES | NC(=O)c1cc2cc(NC(=O)C3(c4ccc(O)c(O)c4)CC3)ccc2[nH]1 |
| InChI | InChI=1S/C19H17N3O4/c20-17(25)14-8-10-7-12(2-3-13(10)22-14)21-18(26)19(5-6-19)11-1-4-15(23)16(24)9-11/h1-4,7-9,22-24H,5-6H2,(H2,20,25)(H,21,26) |
| InChIKey | SMYBXJWFNYQSLN-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 128.44 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|