C24H23NO4 — CID 71174082
1-(3,4-dihydroxyphenyl)-N-[3-[4-(hydroxymethyl)phenyl]-4-methylphenyl]cyclopropane-1-carboxamide (PubChem CID 71174082) has the molecular formula C24H23NO4 and a molecular weight of 389.45 g/mol. Its IUPAC name is 1-(3,4-dihydroxyphenyl)-N-[3-[4-(hydroxymethyl)phenyl]-4-methylphenyl]cyclopropane-1-carboxamide.
| Compound Name | 1-(3,4-dihydroxyphenyl)-N-[3-[4-(hydroxymethyl)phenyl]-4-methylphenyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 71174082 |
| Molecular Formula | C24H23NO4 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | 1-(3,4-dihydroxyphenyl)-N-[3-[4-(hydroxymethyl)phenyl]-4-methylphenyl]cyclopropane-1-carboxamide |
| SMILES | Cc1ccc(NC(=O)C2(c3ccc(O)c(O)c3)CC2)cc1-c1ccc(CO)cc1 |
| InChI | InChI=1S/C24H23NO4/c1-15-2-8-19(13-20(15)17-5-3-16(14-26)4-6-17)25-23(29)24(10-11-24)18-7-9-21(27)22(28)12-18/h2-9,12-13,26-28H,10-11,14H2,1H3,(H,25,29) |
| InChIKey | CEDIPBWIBBORPU-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|