C25H24N2O4 — CID 71174360
3-[4-[[1-(3,4-dihydroxyphenyl)cyclopropanecarbonyl]amino]-2-methylphenyl]-N-methylbenzamide (PubChem CID 71174360) has the molecular formula C25H24N2O4 and a molecular weight of 416.48 g/mol. Its IUPAC name is 3-[4-[[1-(3,4-dihydroxyphenyl)cyclopropanecarbonyl]amino]-2-methylphenyl]-N-methylbenzamide.
| Compound Name | 3-[4-[[1-(3,4-dihydroxyphenyl)cyclopropanecarbonyl]amino]-2-methylphenyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 71174360 |
| Molecular Formula | C25H24N2O4 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | 3-[4-[[1-(3,4-dihydroxyphenyl)cyclopropanecarbonyl]amino]-2-methylphenyl]-N-methylbenzamide |
| SMILES | CNC(=O)c1cccc(-c2ccc(NC(=O)C3(c4ccc(O)c(O)c4)CC3)cc2C)c1 |
| InChI | InChI=1S/C25H24N2O4/c1-15-12-19(7-8-20(15)16-4-3-5-17(13-16)23(30)26-2)27-24(31)25(10-11-25)18-6-9-21(28)22(29)14-18/h3-9,12-14,28-29H,10-11H2,1-2H3,(H,26,30)(H,27,31) |
| InChIKey | BFFQOPFGCDCJOV-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|