C23H17ClF3NO3 — CID 71174092
N-[4-(3-chlorophenyl)-3-(trifluoromethyl)phenyl]-1-(3,4-dihydroxyphenyl)cyclopropane-1-carboxamide (PubChem CID 71174092) has the molecular formula C23H17ClF3NO3 and a molecular weight of 447.84 g/mol. Its IUPAC name is N-[4-(3-chlorophenyl)-3-(trifluoromethyl)phenyl]-1-(3,4-dihydroxyphenyl)cyclopropane-1-carboxamide.
| Compound Name | N-[4-(3-chlorophenyl)-3-(trifluoromethyl)phenyl]-1-(3,4-dihydroxyphenyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 71174092 |
| Molecular Formula | C23H17ClF3NO3 |
| Molecular Weight | 447.84 g/mol |
| Exact Mass | 447.08 |
| IUPAC Name | N-[4-(3-chlorophenyl)-3-(trifluoromethyl)phenyl]-1-(3,4-dihydroxyphenyl)cyclopropane-1-carboxamide |
| SMILES | O=C(Nc1ccc(-c2cccc(Cl)c2)c(C(F)(F)F)c1)C1(c2ccc(O)c(O)c2)CC1 |
| InChI | InChI=1S/C23H17ClF3NO3/c24-15-3-1-2-13(10-15)17-6-5-16(12-18(17)23(25,26)27)28-21(31)22(8-9-22)14-4-7-19(29)20(30)11-14/h1-7,10-12,29-30H,8-9H2,(H,28,31) |
| InChIKey | LXJHSDDFJGFPCT-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.84 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|