C22H17ClFNO3 — CID 71174408
N-[5-(2-chlorophenyl)-2-fluorophenyl]-1-(3,4-dihydroxyphenyl)cyclopropane-1-carboxamide (PubChem CID 71174408) has the molecular formula C22H17ClFNO3 and a molecular weight of 397.83 g/mol. Its IUPAC name is N-[5-(2-chlorophenyl)-2-fluorophenyl]-1-(3,4-dihydroxyphenyl)cyclopropane-1-carboxamide.
| Compound Name | N-[5-(2-chlorophenyl)-2-fluorophenyl]-1-(3,4-dihydroxyphenyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 71174408 |
| Molecular Formula | C22H17ClFNO3 |
| Molecular Weight | 397.83 g/mol |
| Exact Mass | 397.09 |
| IUPAC Name | N-[5-(2-chlorophenyl)-2-fluorophenyl]-1-(3,4-dihydroxyphenyl)cyclopropane-1-carboxamide |
| SMILES | O=C(Nc1cc(-c2ccccc2Cl)ccc1F)C1(c2ccc(O)c(O)c2)CC1 |
| InChI | InChI=1S/C22H17ClFNO3/c23-16-4-2-1-3-15(16)13-5-7-17(24)18(11-13)25-21(28)22(9-10-22)14-6-8-19(26)20(27)12-14/h1-8,11-12,26-27H,9-10H2,(H,25,28) |
| InChIKey | IPCOICFKPLOCSZ-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.83 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|