C24H18FN2O4 — CID 59206260
CID 59206260 (PubChem CID 59206260) has the molecular formula C24H18FN2O4 and a molecular weight of 417.42 g/mol.
| Compound Name | CID 59206260 |
|---|---|
| PubChem CID | 59206260 |
| Molecular Formula | C24H18FN2O4 |
| Molecular Weight | 417.42 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | — |
| SMILES | [NH]C(=O)c1cccc(-c2ccc(F)c(NC(=O)C3(c4ccc5c(c4)OCO5)CC3)c2)c1 |
| InChI | InChI=1S/C24H18FN2O4/c25-18-6-4-15(14-2-1-3-16(10-14)22(26)28)11-19(18)27-23(29)24(8-9-24)17-5-7-20-21(12-17)31-13-30-20/h1-7,10-12,26H,8-9,13H2,(H,27,29) |
| InChIKey | LAJLMLYROJVNAW-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 88.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.42 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |