C23H18FN2O5S — CID 59206942
CID 59206942 (PubChem CID 59206942) has the molecular formula C23H18FN2O5S and a molecular weight of 453.47 g/mol.
| Compound Name | CID 59206942 |
|---|---|
| PubChem CID | 59206942 |
| Molecular Formula | C23H18FN2O5S |
| Molecular Weight | 453.47 g/mol |
| Exact Mass | 453.09 |
| IUPAC Name | — |
| SMILES | [NH]S(=O)(=O)c1ccc(-c2ccc(F)c(NC(=O)C3(c4ccc5c(c4)OCO5)CC3)c2)cc1 |
| InChI | InChI=1S/C23H18FN2O5S/c24-18-7-3-15(14-1-5-17(6-2-14)32(25,28)29)11-19(18)26-22(27)23(9-10-23)16-4-8-20-21(12-16)31-13-30-20/h1-8,11-12,25H,9-10,13H2,(H,26,27) |
| InChIKey | SLSGYESWSUSCBW-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 105.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.47 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |