C27H29NO4 — CID 71174364
N-[4-tert-butyl-3-[4-(hydroxymethyl)phenyl]phenyl]-1-(3,4-dihydroxyphenyl)cyclopropane-1-carboxamide (PubChem CID 71174364) has the molecular formula C27H29NO4 and a molecular weight of 431.53 g/mol. Its IUPAC name is N-[4-tert-butyl-3-[4-(hydroxymethyl)phenyl]phenyl]-1-(3,4-dihydroxyphenyl)cyclopropane-1-carboxamide.
| Compound Name | N-[4-tert-butyl-3-[4-(hydroxymethyl)phenyl]phenyl]-1-(3,4-dihydroxyphenyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 71174364 |
| Molecular Formula | C27H29NO4 |
| Molecular Weight | 431.53 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | N-[4-tert-butyl-3-[4-(hydroxymethyl)phenyl]phenyl]-1-(3,4-dihydroxyphenyl)cyclopropane-1-carboxamide |
| SMILES | CC(C)(C)c1ccc(NC(=O)C2(c3ccc(O)c(O)c3)CC2)cc1-c1ccc(CO)cc1 |
| InChI | InChI=1S/C27H29NO4/c1-26(2,3)22-10-9-20(15-21(22)18-6-4-17(16-29)5-7-18)28-25(32)27(12-13-27)19-8-11-23(30)24(31)14-19/h4-11,14-15,29-31H,12-13,16H2,1-3H3,(H,28,32) |
| InChIKey | XYSKRUQITIRFHU-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.53 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|