C25H23NO6 — CID 71174148
3-[5-[[1-(3,4-dihydroxyphenyl)cyclopropanecarbonyl]amino]-2-methylphenyl]-4-methoxybenzoic acid (PubChem CID 71174148) has the molecular formula C25H23NO6 and a molecular weight of 433.46 g/mol. Its IUPAC name is 3-[5-[[1-(3,4-dihydroxyphenyl)cyclopropanecarbonyl]amino]-2-methylphenyl]-4-methoxybenzoic acid.
| Compound Name | 3-[5-[[1-(3,4-dihydroxyphenyl)cyclopropanecarbonyl]amino]-2-methylphenyl]-4-methoxybenzoic acid |
|---|---|
| PubChem CID | 71174148 |
| Molecular Formula | C25H23NO6 |
| Molecular Weight | 433.46 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | 3-[5-[[1-(3,4-dihydroxyphenyl)cyclopropanecarbonyl]amino]-2-methylphenyl]-4-methoxybenzoic acid |
| SMILES | COc1ccc(C(=O)O)cc1-c1cc(NC(=O)C2(c3ccc(O)c(O)c3)CC2)ccc1C |
| InChI | InChI=1S/C25H23NO6/c1-14-3-6-17(13-18(14)19-11-15(23(29)30)4-8-22(19)32-2)26-24(31)25(9-10-25)16-5-7-20(27)21(28)12-16/h3-8,11-13,27-28H,9-10H2,1-2H3,(H,26,31)(H,29,30) |
| InChIKey | POASUYWXAVJIQD-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.46 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|