C29H30N2O4 — CID 71174377
1-(3,4-dihydroxyphenyl)-N-[4-methyl-3-[4-(piperidine-1-carbonyl)phenyl]phenyl]cyclopropane-1-carboxamide (PubChem CID 71174377) has the molecular formula C29H30N2O4 and a molecular weight of 470.57 g/mol. Its IUPAC name is 1-(3,4-dihydroxyphenyl)-N-[4-methyl-3-[4-(piperidine-1-carbonyl)phenyl]phenyl]cyclopropane-1-carboxamide.
| Compound Name | 1-(3,4-dihydroxyphenyl)-N-[4-methyl-3-[4-(piperidine-1-carbonyl)phenyl]phenyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 71174377 |
| Molecular Formula | C29H30N2O4 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.22 |
| IUPAC Name | 1-(3,4-dihydroxyphenyl)-N-[4-methyl-3-[4-(piperidine-1-carbonyl)phenyl]phenyl]cyclopropane-1-carboxamide |
| SMILES | Cc1ccc(NC(=O)C2(c3ccc(O)c(O)c3)CC2)cc1-c1ccc(C(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C29H30N2O4/c1-19-5-11-23(30-28(35)29(13-14-29)22-10-12-25(32)26(33)17-22)18-24(19)20-6-8-21(9-7-20)27(34)31-15-3-2-4-16-31/h5-12,17-18,32-33H,2-4,13-16H2,1H3,(H,30,35) |
| InChIKey | ZTJDAZHNBZPYPD-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|