C28H28N2O3 — CID 89341199
1-[4-[5-[1-[1-(3,4-dihydroxyphenyl)cyclopropyl]ethenylamino]-2-methylphenyl]phenyl]pyrrolidin-2-one (PubChem CID 89341199) has the molecular formula C28H28N2O3 and a molecular weight of 440.54 g/mol. Its IUPAC name is 1-[4-[5-[1-[1-(3,4-dihydroxyphenyl)cyclopropyl]ethenylamino]-2-methylphenyl]phenyl]pyrrolidin-2-one.
| Compound Name | 1-[4-[5-[1-[1-(3,4-dihydroxyphenyl)cyclopropyl]ethenylamino]-2-methylphenyl]phenyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 89341199 |
| Molecular Formula | C28H28N2O3 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | 1-[4-[5-[1-[1-(3,4-dihydroxyphenyl)cyclopropyl]ethenylamino]-2-methylphenyl]phenyl]pyrrolidin-2-one |
| SMILES | C=C(Nc1ccc(C)c(-c2ccc(N3CCCC3=O)cc2)c1)C1(c2ccc(O)c(O)c2)CC1 |
| InChI | InChI=1S/C28H28N2O3/c1-18-5-9-22(29-19(2)28(13-14-28)21-8-12-25(31)26(32)16-21)17-24(18)20-6-10-23(11-7-20)30-15-3-4-27(30)33/h5-12,16-17,29,31-32H,2-4,13-15H2,1H3 |
| InChIKey | IUFQJGPVOCROSA-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|