C25H24F3N3O2 — CID 153341446
1-[4-(2-methylphenyl)phenyl]pyrrolidin-2-one;[4-(trifluoromethyl)phenyl]urea (PubChem CID 153341446) has the molecular formula C25H24F3N3O2 and a molecular weight of 455.48 g/mol. Its IUPAC name is 1-[4-(2-methylphenyl)phenyl]pyrrolidin-2-one;[4-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[4-(2-methylphenyl)phenyl]pyrrolidin-2-one;[4-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 153341446 |
| Molecular Formula | C25H24F3N3O2 |
| Molecular Weight | 455.48 g/mol |
| Exact Mass | 455.18 |
| IUPAC Name | 1-[4-(2-methylphenyl)phenyl]pyrrolidin-2-one;[4-(trifluoromethyl)phenyl]urea |
| SMILES | Cc1ccccc1-c1ccc(N2CCCC2=O)cc1.NC(=O)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H17NO.C8H7F3N2O/c1-13-5-2-3-6-16(13)14-8-10-15(11-9-14)18-12-4-7-17(18)19;9-8(10,11)5-1-3-6(4-2-5)13-7(12)14/h2-3,5-6,8-11H,4,7,12H2,1H3;1-4H,(H3,12,13,14) |
| InChIKey | GELATIHRQMRJME-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.48 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |