C29H32N2O4 — CID 71174352
4-[5-[[1-(3,4-dihydroxyphenyl)cyclopropanecarbonyl]amino]-2-ethylphenyl]-N,N-diethylbenzamide (PubChem CID 71174352) has the molecular formula C29H32N2O4 and a molecular weight of 472.59 g/mol. Its IUPAC name is 4-[5-[[1-(3,4-dihydroxyphenyl)cyclopropanecarbonyl]amino]-2-ethylphenyl]-N,N-diethylbenzamide.
| Compound Name | 4-[5-[[1-(3,4-dihydroxyphenyl)cyclopropanecarbonyl]amino]-2-ethylphenyl]-N,N-diethylbenzamide |
|---|---|
| PubChem CID | 71174352 |
| Molecular Formula | C29H32N2O4 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.24 |
| IUPAC Name | 4-[5-[[1-(3,4-dihydroxyphenyl)cyclopropanecarbonyl]amino]-2-ethylphenyl]-N,N-diethylbenzamide |
| SMILES | CCc1ccc(NC(=O)C2(c3ccc(O)c(O)c3)CC2)cc1-c1ccc(C(=O)N(CC)CC)cc1 |
| InChI | InChI=1S/C29H32N2O4/c1-4-19-11-13-23(30-28(35)29(15-16-29)22-12-14-25(32)26(33)17-22)18-24(19)20-7-9-21(10-8-20)27(34)31(5-2)6-3/h7-14,17-18,32-33H,4-6,15-16H2,1-3H3,(H,30,35) |
| InChIKey | ZVXPUNCMKHROJG-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|