C24H21F3NO3P — CID 71174126
1-(3,4-dihydroxyphenyl)-N-[4-[4-(phosphanylmethyl)phenyl]-3-(trifluoromethyl)phenyl]cyclopropane-1-carboxamide (PubChem CID 71174126) has the molecular formula C24H21F3NO3P and a molecular weight of 459.40 g/mol. Its IUPAC name is 1-(3,4-dihydroxyphenyl)-N-[4-[4-(phosphanylmethyl)phenyl]-3-(trifluoromethyl)phenyl]cyclopropane-1-carboxamide.
| Compound Name | 1-(3,4-dihydroxyphenyl)-N-[4-[4-(phosphanylmethyl)phenyl]-3-(trifluoromethyl)phenyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 71174126 |
| Molecular Formula | C24H21F3NO3P |
| Molecular Weight | 459.40 g/mol |
| Exact Mass | 459.12 |
| IUPAC Name | 1-(3,4-dihydroxyphenyl)-N-[4-[4-(phosphanylmethyl)phenyl]-3-(trifluoromethyl)phenyl]cyclopropane-1-carboxamide |
| SMILES | O=C(Nc1ccc(-c2ccc(CP)cc2)c(C(F)(F)F)c1)C1(c2ccc(O)c(O)c2)CC1 |
| InChI | InChI=1S/C24H21F3NO3P/c25-24(26,27)19-12-17(6-7-18(19)15-3-1-14(13-32)2-4-15)28-22(31)23(9-10-23)16-5-8-20(29)21(30)11-16/h1-8,11-12,29-30H,9-10,13,32H2,(H,28,31) |
| InChIKey | SPIQLWATCZXOTI-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.40 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|