C17H24N2O3 — CID 143559171
ethyl 3-[5-amino-1-(2-hydroxyethyl)indol-2-yl]-3-methylbutanoate (PubChem CID 143559171) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is ethyl 3-[5-amino-1-(2-hydroxyethyl)indol-2-yl]-3-methylbutanoate.
| Compound Name | ethyl 3-[5-amino-1-(2-hydroxyethyl)indol-2-yl]-3-methylbutanoate |
|---|---|
| PubChem CID | 143559171 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | ethyl 3-[5-amino-1-(2-hydroxyethyl)indol-2-yl]-3-methylbutanoate |
| SMILES | CCOC(=O)CC(C)(C)c1cc2cc(N)ccc2n1CCO |
| InChI | InChI=1S/C17H24N2O3/c1-4-22-16(21)11-17(2,3)15-10-12-9-13(18)5-6-14(12)19(15)7-8-20/h5-6,9-10,20H,4,7-8,11,18H2,1-3H3 |
| InChIKey | YIPOYSPTEAWQBD-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 77.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|