C14H15F3N2O — CID 112534151
1-[5-amino-2-(trifluoromethyl)indol-1-yl]-2,2-dimethylpropan-1-one (PubChem CID 112534151) has the molecular formula C14H15F3N2O and a molecular weight of 284.28 g/mol. Its IUPAC name is 1-[5-amino-2-(trifluoromethyl)indol-1-yl]-2,2-dimethylpropan-1-one.
| Compound Name | 1-[5-amino-2-(trifluoromethyl)indol-1-yl]-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 112534151 |
| Molecular Formula | C14H15F3N2O |
| Molecular Weight | 284.28 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | 1-[5-amino-2-(trifluoromethyl)indol-1-yl]-2,2-dimethylpropan-1-one |
| SMILES | CC(C)(C)C(=O)n1c(C(F)(F)F)cc2cc(N)ccc21 |
| InChI | InChI=1S/C14H15F3N2O/c1-13(2,3)12(20)19-10-5-4-9(18)6-8(10)7-11(19)14(15,16)17/h4-7H,18H2,1-3H3 |
| InChIKey | LWISSDLFPUMJSZ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.28 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|