C11H12F2N2 — CID 165472066
1-(2,2-difluoropropyl)indol-5-amine (PubChem CID 165472066) has the molecular formula C11H12F2N2 and a molecular weight of 210.23 g/mol. Its IUPAC name is 1-(2,2-difluoropropyl)indol-5-amine.
| Compound Name | 1-(2,2-difluoropropyl)indol-5-amine |
|---|---|
| PubChem CID | 165472066 |
| Molecular Formula | C11H12F2N2 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | 1-(2,2-difluoropropyl)indol-5-amine |
| SMILES | CC(F)(F)Cn1ccc2cc(N)ccc21 |
| InChI | InChI=1S/C11H12F2N2/c1-11(12,13)7-15-5-4-8-6-9(14)2-3-10(8)15/h2-6H,7,14H2,1H3 |
| InChIKey | ABKLQRCLCIHHKQ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_no_alk_indol_A(1)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|