About 1-[(4,4-difluorocyclohexyl)methyl]indol-5-amine
1-[(4,4-difluorocyclohexyl)methyl]indol-5-amine (PubChem CID 156881348) has the molecular formula C15H18F2N2
and a molecular weight of 264.32 g/mol. Its IUPAC name is 1-[(4,4-difluorocyclohexyl)methyl]indol-5-amine.
Molecular Properties
| Compound Name | 1-[(4,4-difluorocyclohexyl)methyl]indol-5-amine |
| PubChem CID | 156881348 |
| Molecular Formula | C15H18F2N2 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | 1-[(4,4-difluorocyclohexyl)methyl]indol-5-amine |
| SMILES | Nc1ccc2c(ccn2CC2CCC(F)(F)CC2)c1 |
| InChI | InChI=1S/C15H18F2N2/c16-15(17)6-3-11(4-7-15)10-19-8-5-12-9-13(18)1-2-14(12)19/h1-2,5,8-9,11H,3-4,6-7,10,18H2 |
| InChIKey | ZDYAQAXEDJCVEE-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk_indol_A(1)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 1-[(4,4-difluorocyclohexyl)methyl]indol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4,4-difluorocyclohexyl)methyl]indol-5-amine?
The IUPAC name of 1-[(4,4-difluorocyclohexyl)methyl]indol-5-amine (CID 156881348) is 1-[(4,4-difluorocyclohexyl)methyl]indol-5-amine.
What is the SMILES notation for 1-[(4,4-difluorocyclohexyl)methyl]indol-5-amine?
The canonical SMILES for 1-[(4,4-difluorocyclohexyl)methyl]indol-5-amine is Nc1ccc2c(ccn2CC2CCC(F)(F)CC2)c1.
What is the InChIKey of 1-[(4,4-difluorocyclohexyl)methyl]indol-5-amine?
The InChIKey is ZDYAQAXEDJCVEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18F2N2/c16-15(17)6-3-11(4-7-15)10-19-8-5-12-9-13(18)1-2-14(12)19/h1-2,5,8-9,11H,3-4,6-7,10,18H2.
What are the key properties of 1-[(4,4-difluorocyclohexyl)methyl]indol-5-amine?
1-[(4,4-difluorocyclohexyl)methyl]indol-5-amine has a molecular weight of 264.32 g/mol, XLogP of 4.05, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4,4-difluorocyclohexyl)methyl]indol-5-amine is sourced from PubChem (CID 156881348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).