C14H14Cl2F2N2 — CID 172634701
4,6-dichloro-1-[(4,4-difluorocyclohexyl)methyl]pyrrolo[3,2-c]pyridine (PubChem CID 172634701) has the molecular formula C14H14Cl2F2N2 and a molecular weight of 319.18 g/mol. Its IUPAC name is 4,6-dichloro-1-[(4,4-difluorocyclohexyl)methyl]pyrrolo[3,2-c]pyridine.
| Compound Name | 4,6-dichloro-1-[(4,4-difluorocyclohexyl)methyl]pyrrolo[3,2-c]pyridine |
|---|---|
| PubChem CID | 172634701 |
| Molecular Formula | C14H14Cl2F2N2 |
| Molecular Weight | 319.18 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | 4,6-dichloro-1-[(4,4-difluorocyclohexyl)methyl]pyrrolo[3,2-c]pyridine |
| SMILES | FC1(F)CCC(Cn2ccc3c(Cl)nc(Cl)cc32)CC1 |
| InChI | InChI=1S/C14H14Cl2F2N2/c15-12-7-11-10(13(16)19-12)3-6-20(11)8-9-1-4-14(17,18)5-2-9/h3,6-7,9H,1-2,4-5,8H2 |
| InChIKey | BTZPCJPAAGDSHG-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.18 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|