C18H17Cl2F2N3O2 — CID 90927434
7-chloro-5-[5-(chloromethyl)-1,2,4-oxadiazol-3-yl]-2-[(4,4-difluorocyclohexyl)methyl]isoindol-1-ol (PubChem CID 90927434) has the molecular formula C18H17Cl2F2N3O2 and a molecular weight of 416.26 g/mol. Its IUPAC name is 7-chloro-5-[5-(chloromethyl)-1,2,4-oxadiazol-3-yl]-2-[(4,4-difluorocyclohexyl)methyl]isoindol-1-ol.
| Compound Name | 7-chloro-5-[5-(chloromethyl)-1,2,4-oxadiazol-3-yl]-2-[(4,4-difluorocyclohexyl)methyl]isoindol-1-ol |
|---|---|
| PubChem CID | 90927434 |
| Molecular Formula | C18H17Cl2F2N3O2 |
| Molecular Weight | 416.26 g/mol |
| Exact Mass | 415.07 |
| IUPAC Name | 7-chloro-5-[5-(chloromethyl)-1,2,4-oxadiazol-3-yl]-2-[(4,4-difluorocyclohexyl)methyl]isoindol-1-ol |
| SMILES | Oc1c2c(Cl)cc(-c3noc(CCl)n3)cc2cn1CC1CCC(F)(F)CC1 |
| InChI | InChI=1S/C18H17Cl2F2N3O2/c19-7-14-23-16(24-27-14)11-5-12-9-25(17(26)15(12)13(20)6-11)8-10-1-3-18(21,22)4-2-10/h5-6,9-10,26H,1-4,7-8H2 |
| InChIKey | HXVIMGNRWZLUIL-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.26 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|